1 | //===- LangOptions.h - C Language Family Language Options -------*- C++ -*-===// |
2 | // |
3 | // Part of the LLVM Project, under the Apache License v2.0 with LLVM Exceptions. |
4 | // See https://llvm.org/LICENSE.txt for license information. |
5 | // SPDX-License-Identifier: Apache-2.0 WITH LLVM-exception |
6 | // |
7 | //===----------------------------------------------------------------------===// |
8 | // |
9 | /// \file |
10 | /// Defines the clang::LangOptions interface. |
11 | // |
12 | //===----------------------------------------------------------------------===// |
13 | |
14 | #ifndef LLVM_CLANG_BASIC_LANGOPTIONS_H |
15 | #define LLVM_CLANG_BASIC_LANGOPTIONS_H |
16 | |
17 | #include "clang/Basic/CommentOptions.h" |
18 | #include "clang/Basic/LLVM.h" |
19 | #include "clang/Basic/LangStandard.h" |
20 | #include "clang/Basic/ObjCRuntime.h" |
21 | #include "clang/Basic/Sanitizers.h" |
22 | #include "clang/Basic/TargetCXXABI.h" |
23 | #include "clang/Basic/Visibility.h" |
24 | #include "llvm/ADT/FloatingPointMode.h" |
25 | #include "llvm/ADT/StringRef.h" |
26 | #include "llvm/TargetParser/Triple.h" |
27 | #include <optional> |
28 | #include <string> |
29 | #include <vector> |
30 | |
31 | namespace clang { |
32 | |
33 | /// In the Microsoft ABI, this controls the placement of virtual displacement |
34 | /// members used to implement virtual inheritance. |
35 | enum class MSVtorDispMode { Never, ForVBaseOverride, ForVFTable }; |
36 | |
37 | /// Shader programs run in specific pipeline stages. |
38 | /// The order of these values matters, and must be kept in sync with the |
39 | /// Triple Environment enum in llvm::Triple. The ordering is enforced in |
40 | /// static_asserts in Triple.cpp and in clang/Basic/HLSLRuntime.h. |
41 | enum class ShaderStage { |
42 | Pixel = 0, |
43 | Vertex, |
44 | Geometry, |
45 | Hull, |
46 | Domain, |
47 | Compute, |
48 | Library, |
49 | RayGeneration, |
50 | Intersection, |
51 | AnyHit, |
52 | ClosestHit, |
53 | Miss, |
54 | Callable, |
55 | Mesh, |
56 | Amplification, |
57 | Invalid, |
58 | }; |
59 | |
60 | enum class PointerAuthenticationMode : unsigned { |
61 | None, |
62 | Strip, |
63 | SignAndStrip, |
64 | SignAndAuth |
65 | }; |
66 | |
67 | /// Bitfields of LangOptions, split out from LangOptions in order to ensure that |
68 | /// this large collection of bitfields is a trivial class type. |
69 | class LangOptionsBase { |
70 | friend class CompilerInvocation; |
71 | friend class CompilerInvocationBase; |
72 | |
73 | public: |
74 | using Visibility = clang::Visibility; |
75 | using RoundingMode = llvm::RoundingMode; |
76 | |
77 | enum GCMode { NonGC, GCOnly, HybridGC }; |
78 | enum StackProtectorMode { SSPOff, SSPOn, SSPStrong, SSPReq }; |
79 | |
80 | // Automatic variables live on the stack, and when trivial they're usually |
81 | // uninitialized because it's undefined behavior to use them without |
82 | // initializing them. |
83 | enum class TrivialAutoVarInitKind { Uninitialized, Zero, Pattern }; |
84 | |
85 | enum SignedOverflowBehaviorTy { |
86 | // Default C standard behavior. |
87 | SOB_Undefined, |
88 | |
89 | // -fwrapv |
90 | SOB_Defined, |
91 | |
92 | // -ftrapv |
93 | SOB_Trapping |
94 | }; |
95 | |
96 | // FIXME: Unify with TUKind. |
97 | enum CompilingModuleKind { |
98 | /// Not compiling a module interface at all. |
99 | CMK_None, |
100 | |
101 | /// Compiling a module from a module map. |
102 | CMK_ModuleMap, |
103 | |
104 | /// Compiling a module header unit. |
105 | , |
106 | |
107 | /// Compiling a C++ modules interface unit. |
108 | CMK_ModuleInterface, |
109 | }; |
110 | |
111 | enum PragmaMSPointersToMembersKind { |
112 | PPTMK_BestCase, |
113 | PPTMK_FullGeneralitySingleInheritance, |
114 | PPTMK_FullGeneralityMultipleInheritance, |
115 | PPTMK_FullGeneralityVirtualInheritance |
116 | }; |
117 | |
118 | using MSVtorDispMode = clang::MSVtorDispMode; |
119 | |
120 | enum DefaultCallingConvention { |
121 | DCC_None, |
122 | DCC_CDecl, |
123 | DCC_FastCall, |
124 | DCC_StdCall, |
125 | DCC_VectorCall, |
126 | DCC_RegCall, |
127 | DCC_RtdCall |
128 | }; |
129 | |
130 | enum AddrSpaceMapMangling { ASMM_Target, ASMM_On, ASMM_Off }; |
131 | |
132 | // Corresponds to _MSC_VER |
133 | enum MSVCMajorVersion { |
134 | MSVC2010 = 1600, |
135 | MSVC2012 = 1700, |
136 | MSVC2013 = 1800, |
137 | MSVC2015 = 1900, |
138 | MSVC2017 = 1910, |
139 | MSVC2017_5 = 1912, |
140 | MSVC2017_7 = 1914, |
141 | MSVC2019 = 1920, |
142 | MSVC2019_5 = 1925, |
143 | MSVC2019_8 = 1928, |
144 | MSVC2022_3 = 1933, |
145 | }; |
146 | |
147 | enum SYCLMajorVersion { |
148 | SYCL_None, |
149 | SYCL_2017, |
150 | SYCL_2020, |
151 | // The "default" SYCL version to be used when none is specified on the |
152 | // frontend command line. |
153 | SYCL_Default = SYCL_2020 |
154 | }; |
155 | |
156 | enum HLSLLangStd { |
157 | HLSL_Unset = 0, |
158 | HLSL_2015 = 2015, |
159 | HLSL_2016 = 2016, |
160 | HLSL_2017 = 2017, |
161 | HLSL_2018 = 2018, |
162 | HLSL_2021 = 2021, |
163 | HLSL_202x = 2029, |
164 | }; |
165 | |
166 | /// Clang versions with different platform ABI conformance. |
167 | enum class ClangABI { |
168 | /// Attempt to be ABI-compatible with code generated by Clang 3.8.x |
169 | /// (SVN r257626). This causes <1 x long long> to be passed in an |
170 | /// integer register instead of an SSE register on x64_64. |
171 | Ver3_8, |
172 | |
173 | /// Attempt to be ABI-compatible with code generated by Clang 4.0.x |
174 | /// (SVN r291814). This causes move operations to be ignored when |
175 | /// determining whether a class type can be passed or returned directly. |
176 | Ver4, |
177 | |
178 | /// Attempt to be ABI-compatible with code generated by Clang 6.0.x |
179 | /// (SVN r321711). This causes determination of whether a type is |
180 | /// standard-layout to ignore collisions between empty base classes |
181 | /// and between base classes and member subobjects, which affects |
182 | /// whether we reuse base class tail padding in some ABIs. |
183 | Ver6, |
184 | |
185 | /// Attempt to be ABI-compatible with code generated by Clang 7.0.x |
186 | /// (SVN r338536). This causes alignof (C++) and _Alignof (C11) to be |
187 | /// compatible with __alignof (i.e., return the preferred alignment) |
188 | /// rather than returning the required alignment. |
189 | Ver7, |
190 | |
191 | /// Attempt to be ABI-compatible with code generated by Clang 9.0.x |
192 | /// (SVN r351319). This causes vectors of __int128 to be passed in memory |
193 | /// instead of passing in multiple scalar registers on x86_64 on Linux and |
194 | /// NetBSD. |
195 | Ver9, |
196 | |
197 | /// Attempt to be ABI-compatible with code generated by Clang 11.0.x |
198 | /// (git 2e10b7a39b93). This causes clang to pass unions with a 256-bit |
199 | /// vector member on the stack instead of using registers, to not properly |
200 | /// mangle substitutions for template names in some cases, and to mangle |
201 | /// declaration template arguments without a cast to the parameter type |
202 | /// even when that can lead to mangling collisions. |
203 | Ver11, |
204 | |
205 | /// Attempt to be ABI-compatible with code generated by Clang 12.0.x |
206 | /// (git 8e464dd76bef). This causes clang to mangle lambdas within |
207 | /// global-scope inline variables incorrectly. |
208 | Ver12, |
209 | |
210 | /// Attempt to be ABI-compatible with code generated by Clang 14.0.x. |
211 | /// This causes clang to: |
212 | /// - mangle dependent nested names incorrectly. |
213 | /// - make trivial only those defaulted copy constructors with a |
214 | /// parameter-type-list equivalent to the parameter-type-list of an |
215 | /// implicit declaration. |
216 | Ver14, |
217 | |
218 | /// Attempt to be ABI-compatible with code generated by Clang 15.0.x. |
219 | /// This causes clang to: |
220 | /// - Reverse the implementation for DR692, DR1395 and DR1432. |
221 | /// - pack non-POD members of packed structs. |
222 | /// - consider classes with defaulted special member functions non-pod. |
223 | Ver15, |
224 | |
225 | /// Attempt to be ABI-compatible with code generated by Clang 17.0.x. |
226 | /// This causes clang to revert some fixes to its implementation of the |
227 | /// Itanium name mangling scheme, with the consequence that overloaded |
228 | /// function templates are mangled the same if they differ only by: |
229 | /// - constraints |
230 | /// - whether a non-type template parameter has a deduced type |
231 | /// - the parameter list of a template template parameter |
232 | Ver17, |
233 | |
234 | /// Attempt to be ABI-compatible with code generated by Clang 18.0.x. |
235 | /// This causes clang to revert some fixes to the mangling of lambdas |
236 | /// in the initializers of members of local classes. |
237 | Ver18, |
238 | |
239 | /// Conform to the underlying platform's C and C++ ABIs as closely |
240 | /// as we can. |
241 | Latest |
242 | }; |
243 | |
244 | enum class CoreFoundationABI { |
245 | /// No interoperability ABI has been specified |
246 | Unspecified, |
247 | /// CoreFoundation does not have any language interoperability |
248 | Standalone, |
249 | /// Interoperability with the ObjectiveC runtime |
250 | ObjectiveC, |
251 | /// Interoperability with the latest known version of the Swift runtime |
252 | Swift, |
253 | /// Interoperability with the Swift 5.0 runtime |
254 | Swift5_0, |
255 | /// Interoperability with the Swift 4.2 runtime |
256 | Swift4_2, |
257 | /// Interoperability with the Swift 4.1 runtime |
258 | Swift4_1, |
259 | }; |
260 | |
261 | enum FPModeKind { |
262 | // Disable the floating point pragma |
263 | FPM_Off, |
264 | |
265 | // Enable the floating point pragma |
266 | FPM_On, |
267 | |
268 | // Aggressively fuse FP ops (E.g. FMA) disregarding pragmas. |
269 | FPM_Fast, |
270 | |
271 | // Aggressively fuse FP ops and honor pragmas. |
272 | FPM_FastHonorPragmas |
273 | }; |
274 | |
275 | /// Possible floating point exception behavior. |
276 | enum FPExceptionModeKind { |
277 | /// Assume that floating-point exceptions are masked. |
278 | FPE_Ignore, |
279 | /// Transformations do not cause new exceptions but may hide some. |
280 | FPE_MayTrap, |
281 | /// Strictly preserve the floating-point exception semantics. |
282 | FPE_Strict, |
283 | /// Used internally to represent initial unspecified value. |
284 | FPE_Default |
285 | }; |
286 | |
287 | /// Possible float expression evaluation method choices. |
288 | enum FPEvalMethodKind { |
289 | /// The evaluation method cannot be determined or is inconsistent for this |
290 | /// target. |
291 | FEM_Indeterminable = -1, |
292 | /// Use the declared type for fp arithmetic. |
293 | FEM_Source = 0, |
294 | /// Use the type double for fp arithmetic. |
295 | FEM_Double = 1, |
296 | /// Use extended type for fp arithmetic. |
297 | FEM_Extended = 2, |
298 | /// Used only for FE option processing; this is only used to indicate that |
299 | /// the user did not specify an explicit evaluation method on the command |
300 | /// line and so the target should be queried for its default evaluation |
301 | /// method instead. |
302 | FEM_UnsetOnCommandLine = 3 |
303 | }; |
304 | |
305 | enum ExcessPrecisionKind { FPP_Standard, FPP_Fast, FPP_None }; |
306 | |
307 | /// Possible exception handling behavior. |
308 | enum class ExceptionHandlingKind { None, SjLj, WinEH, DwarfCFI, Wasm }; |
309 | |
310 | enum class LaxVectorConversionKind { |
311 | /// Permit no implicit vector bitcasts. |
312 | None, |
313 | /// Permit vector bitcasts between integer vectors with different numbers |
314 | /// of elements but the same total bit-width. |
315 | Integer, |
316 | /// Permit vector bitcasts between all vectors with the same total |
317 | /// bit-width. |
318 | All, |
319 | }; |
320 | |
321 | enum class AltivecSrcCompatKind { |
322 | // All vector compares produce scalars except vector pixel and vector bool. |
323 | // The types vector pixel and vector bool return vector results. |
324 | Mixed, |
325 | // All vector compares produce vector results as in GCC. |
326 | GCC, |
327 | // All vector compares produce scalars as in XL. |
328 | XL, |
329 | // Default clang behaviour. |
330 | Default = Mixed, |
331 | }; |
332 | |
333 | enum class SignReturnAddressScopeKind { |
334 | /// No signing for any function. |
335 | None, |
336 | /// Sign the return address of functions that spill LR. |
337 | NonLeaf, |
338 | /// Sign the return address of all functions, |
339 | All |
340 | }; |
341 | |
342 | enum class SignReturnAddressKeyKind { |
343 | /// Return address signing uses APIA key. |
344 | AKey, |
345 | /// Return address signing uses APIB key. |
346 | BKey |
347 | }; |
348 | |
349 | enum class ThreadModelKind { |
350 | /// POSIX Threads. |
351 | POSIX, |
352 | /// Single Threaded Environment. |
353 | Single |
354 | }; |
355 | |
356 | enum class ExtendArgsKind { |
357 | /// Integer arguments are sign or zero extended to 32/64 bits |
358 | /// during default argument promotions. |
359 | ExtendTo32, |
360 | ExtendTo64 |
361 | }; |
362 | |
363 | enum class GPUDefaultStreamKind { |
364 | /// Legacy default stream |
365 | Legacy, |
366 | /// Per-thread default stream |
367 | PerThread, |
368 | }; |
369 | |
370 | enum class DefaultVisiblityExportMapping { |
371 | None, |
372 | /// map only explicit default visibilities to exported |
373 | Explicit, |
374 | /// map all default visibilities to exported |
375 | All, |
376 | }; |
377 | |
378 | enum class VisibilityForcedKinds { |
379 | /// Force hidden visibility |
380 | ForceHidden, |
381 | /// Force protected visibility |
382 | ForceProtected, |
383 | /// Force default visibility |
384 | ForceDefault, |
385 | /// Don't alter the visibility |
386 | Source, |
387 | }; |
388 | |
389 | enum class VisibilityFromDLLStorageClassKinds { |
390 | /// Keep the IR-gen assigned visibility. |
391 | Keep, |
392 | /// Override the IR-gen assigned visibility with default visibility. |
393 | Default, |
394 | /// Override the IR-gen assigned visibility with hidden visibility. |
395 | Hidden, |
396 | /// Override the IR-gen assigned visibility with protected visibility. |
397 | Protected, |
398 | }; |
399 | |
400 | enum class StrictFlexArraysLevelKind { |
401 | /// Any trailing array member is a FAM. |
402 | Default = 0, |
403 | /// Any trailing array member of undefined, 0, or 1 size is a FAM. |
404 | OneZeroOrIncomplete = 1, |
405 | /// Any trailing array member of undefined or 0 size is a FAM. |
406 | ZeroOrIncomplete = 2, |
407 | /// Any trailing array member of undefined size is a FAM. |
408 | IncompleteOnly = 3, |
409 | }; |
410 | |
411 | /// Controls the various implementations for complex multiplication and |
412 | // division. |
413 | enum ComplexRangeKind { |
414 | /// Implementation of complex division and multiplication using a call to |
415 | /// runtime library functions(generally the case, but the BE might |
416 | /// sometimes replace the library call if it knows enough about the |
417 | /// potential range of the inputs). Overflow and non-finite values are |
418 | /// handled by the library implementation. This is the default value. |
419 | CX_Full, |
420 | |
421 | /// Implementation of complex division offering an improved handling |
422 | /// for overflow in intermediate calculations with no special handling for |
423 | /// NaN and infinite values. |
424 | CX_Improved, |
425 | |
426 | /// Implementation of complex division using algebraic formulas at |
427 | /// higher precision. Overflow is handled. Non-finite values are handled in |
428 | /// some cases. If the target hardware does not have native support for a |
429 | /// higher precision data type, an implementation for the complex operation |
430 | /// will be used to provide improved guards against intermediate overflow, |
431 | /// but overflow and underflow may still occur in some cases. NaN and |
432 | /// infinite values are not handled. |
433 | CX_Promoted, |
434 | |
435 | /// Implementation of complex division and multiplication using |
436 | /// algebraic formulas at source precision. No special handling to avoid |
437 | /// overflow. NaN and infinite values are not handled. |
438 | CX_Basic, |
439 | |
440 | /// No range rule is enabled. |
441 | CX_None |
442 | }; |
443 | |
444 | // Define simple language options (with no accessors). |
445 | #define LANGOPT(Name, Bits, Default, Description) unsigned Name : Bits; |
446 | #define ENUM_LANGOPT(Name, Type, Bits, Default, Description) |
447 | #include "clang/Basic/LangOptions.def" |
448 | |
449 | protected: |
450 | // Define language options of enumeration type. These are private, and will |
451 | // have accessors (below). |
452 | #define LANGOPT(Name, Bits, Default, Description) |
453 | #define ENUM_LANGOPT(Name, Type, Bits, Default, Description) \ |
454 | LLVM_PREFERRED_TYPE(Type) \ |
455 | unsigned Name : Bits; |
456 | #include "clang/Basic/LangOptions.def" |
457 | }; |
458 | |
459 | /// Keeps track of the various options that can be |
460 | /// enabled, which controls the dialect of C or C++ that is accepted. |
461 | class LangOptions : public LangOptionsBase { |
462 | public: |
463 | /// The used language standard. |
464 | LangStandard::Kind LangStd; |
465 | |
466 | /// Set of enabled sanitizers. |
467 | SanitizerSet Sanitize; |
468 | /// Is at least one coverage instrumentation type enabled. |
469 | bool SanitizeCoverage = false; |
470 | |
471 | /// Paths to files specifying which objects |
472 | /// (files, functions, variables) should not be instrumented. |
473 | std::vector<std::string> NoSanitizeFiles; |
474 | |
475 | /// Paths to the XRay "always instrument" files specifying which |
476 | /// objects (files, functions, variables) should be imbued with the XRay |
477 | /// "always instrument" attribute. |
478 | /// WARNING: This is a deprecated field and will go away in the future. |
479 | std::vector<std::string> XRayAlwaysInstrumentFiles; |
480 | |
481 | /// Paths to the XRay "never instrument" files specifying which |
482 | /// objects (files, functions, variables) should be imbued with the XRay |
483 | /// "never instrument" attribute. |
484 | /// WARNING: This is a deprecated field and will go away in the future. |
485 | std::vector<std::string> XRayNeverInstrumentFiles; |
486 | |
487 | /// Paths to the XRay attribute list files, specifying which objects |
488 | /// (files, functions, variables) should be imbued with the appropriate XRay |
489 | /// attribute(s). |
490 | std::vector<std::string> XRayAttrListFiles; |
491 | |
492 | /// Paths to special case list files specifying which entities |
493 | /// (files, functions) should or should not be instrumented. |
494 | std::vector<std::string> ProfileListFiles; |
495 | |
496 | clang::ObjCRuntime ObjCRuntime; |
497 | |
498 | CoreFoundationABI CFRuntime = CoreFoundationABI::Unspecified; |
499 | |
500 | std::string ObjCConstantStringClass; |
501 | |
502 | /// The name of the handler function to be called when -ftrapv is |
503 | /// specified. |
504 | /// |
505 | /// If none is specified, abort (GCC-compatible behaviour). |
506 | std::string OverflowHandler; |
507 | |
508 | /// The module currently being compiled as specified by -fmodule-name. |
509 | std::string ModuleName; |
510 | |
511 | /// The name of the current module, of which the main source file |
512 | /// is a part. If CompilingModule is set, we are compiling the interface |
513 | /// of this module, otherwise we are compiling an implementation file of |
514 | /// it. This starts as ModuleName in case -fmodule-name is provided and |
515 | /// changes during compilation to reflect the current module. |
516 | std::string CurrentModule; |
517 | |
518 | /// The names of any features to enable in module 'requires' decls |
519 | /// in addition to the hard-coded list in Module.cpp and the target features. |
520 | /// |
521 | /// This list is sorted. |
522 | std::vector<std::string> ModuleFeatures; |
523 | |
524 | /// Options for parsing comments. |
525 | CommentOptions ; |
526 | |
527 | /// A list of all -fno-builtin-* function names (e.g., memset). |
528 | std::vector<std::string> NoBuiltinFuncs; |
529 | |
530 | /// A prefix map for __FILE__, __BASE_FILE__ and __builtin_FILE(). |
531 | std::map<std::string, std::string, std::greater<std::string>> MacroPrefixMap; |
532 | |
533 | /// Triples of the OpenMP targets that the host code codegen should |
534 | /// take into account in order to generate accurate offloading descriptors. |
535 | std::vector<llvm::Triple> OMPTargetTriples; |
536 | |
537 | /// Name of the IR file that contains the result of the OpenMP target |
538 | /// host code generation. |
539 | std::string OMPHostIRFile; |
540 | |
541 | /// The user provided compilation unit ID, if non-empty. This is used to |
542 | /// externalize static variables which is needed to support accessing static |
543 | /// device variables in host code for single source offloading languages |
544 | /// like CUDA/HIP. |
545 | std::string CUID; |
546 | |
547 | /// C++ ABI to compile with, if specified by the frontend through -fc++-abi=. |
548 | /// This overrides the default ABI used by the target. |
549 | std::optional<TargetCXXABI::Kind> CXXABI; |
550 | |
551 | /// Indicates whether the front-end is explicitly told that the |
552 | /// input is a header file (i.e. -x c-header). |
553 | bool = false; |
554 | |
555 | /// The default stream kind used for HIP kernel launching. |
556 | GPUDefaultStreamKind GPUDefaultStream; |
557 | |
558 | /// The seed used by the randomize structure layout feature. |
559 | std::string RandstructSeed; |
560 | |
561 | /// Indicates whether to use target's platform-specific file separator when |
562 | /// __FILE__ macro is used and when concatenating filename with directory or |
563 | /// to use build environment environment's platform-specific file separator. |
564 | /// |
565 | /// The plaform-specific path separator is the backslash(\) for Windows and |
566 | /// forward slash (/) elsewhere. |
567 | bool UseTargetPathSeparator = false; |
568 | |
569 | // Indicates whether we should keep all nullptr checks for pointers |
570 | // received as a result of a standard operator new (-fcheck-new) |
571 | bool CheckNew = false; |
572 | |
573 | // In OpenACC mode, contains a user provided override for the _OPENACC macro. |
574 | // This exists so that we can override the macro value and test our incomplete |
575 | // implementation on real-world examples. |
576 | std::string OpenACCMacroOverride; |
577 | |
578 | // Indicates if the wasm-opt binary must be ignored in the case of a |
579 | // WebAssembly target. |
580 | bool NoWasmOpt = false; |
581 | |
582 | LangOptions(); |
583 | |
584 | /// Set language defaults for the given input language and |
585 | /// language standard in the given LangOptions object. |
586 | /// |
587 | /// \param Opts - The LangOptions object to set up. |
588 | /// \param Lang - The input language. |
589 | /// \param T - The target triple. |
590 | /// \param Includes - If the language requires extra headers to be implicitly |
591 | /// included, they will be appended to this list. |
592 | /// \param LangStd - The input language standard. |
593 | static void |
594 | setLangDefaults(LangOptions &Opts, Language Lang, const llvm::Triple &T, |
595 | std::vector<std::string> &Includes, |
596 | LangStandard::Kind LangStd = LangStandard::lang_unspecified); |
597 | |
598 | // Define accessors/mutators for language options of enumeration type. |
599 | #define LANGOPT(Name, Bits, Default, Description) |
600 | #define ENUM_LANGOPT(Name, Type, Bits, Default, Description) \ |
601 | Type get##Name() const { return static_cast<Type>(Name); } \ |
602 | void set##Name(Type Value) { Name = static_cast<unsigned>(Value); } |
603 | #include "clang/Basic/LangOptions.def" |
604 | |
605 | /// Are we compiling a module? |
606 | bool isCompilingModule() const { |
607 | return getCompilingModule() != CMK_None; |
608 | } |
609 | |
610 | /// Are we compiling a module implementation? |
611 | bool isCompilingModuleImplementation() const { |
612 | return !isCompilingModule() && !ModuleName.empty(); |
613 | } |
614 | |
615 | /// Do we need to track the owning module for a local declaration? |
616 | bool trackLocalOwningModule() const { |
617 | return isCompilingModule() || ModulesLocalVisibility; |
618 | } |
619 | |
620 | bool isSignedOverflowDefined() const { |
621 | return getSignedOverflowBehavior() == SOB_Defined; |
622 | } |
623 | |
624 | bool isSubscriptPointerArithmetic() const { |
625 | return ObjCRuntime.isSubscriptPointerArithmetic() && |
626 | !ObjCSubscriptingLegacyRuntime; |
627 | } |
628 | |
629 | bool isCompatibleWithMSVC(MSVCMajorVersion MajorVersion) const { |
630 | return MSCompatibilityVersion >= MajorVersion * 100000U; |
631 | } |
632 | |
633 | /// Reset all of the options that are not considered when building a |
634 | /// module. |
635 | void resetNonModularOptions(); |
636 | |
637 | /// Is this a libc/libm function that is no longer recognized as a |
638 | /// builtin because a -fno-builtin-* option has been specified? |
639 | bool isNoBuiltinFunc(StringRef Name) const; |
640 | |
641 | /// True if any ObjC types may have non-trivial lifetime qualifiers. |
642 | bool allowsNonTrivialObjCLifetimeQualifiers() const { |
643 | return ObjCAutoRefCount || ObjCWeak; |
644 | } |
645 | |
646 | bool assumeFunctionsAreConvergent() const { |
647 | return ConvergentFunctions; |
648 | } |
649 | |
650 | /// Return the OpenCL C or C++ version as a VersionTuple. |
651 | VersionTuple getOpenCLVersionTuple() const; |
652 | |
653 | /// Return the OpenCL version that kernel language is compatible with |
654 | unsigned getOpenCLCompatibleVersion() const; |
655 | |
656 | /// Return the OpenCL C or C++ for OpenCL language name and version |
657 | /// as a string. |
658 | std::string getOpenCLVersionString() const; |
659 | |
660 | /// Returns true if functions without prototypes or functions with an |
661 | /// identifier list (aka K&R C functions) are not allowed. |
662 | bool requiresStrictPrototypes() const { |
663 | return CPlusPlus || C23 || DisableKNRFunctions; |
664 | } |
665 | |
666 | /// Returns true if implicit function declarations are allowed in the current |
667 | /// language mode. |
668 | bool implicitFunctionsAllowed() const { |
669 | return !requiresStrictPrototypes() && !OpenCL; |
670 | } |
671 | |
672 | /// Returns true if the language supports calling the 'atexit' function. |
673 | bool hasAtExit() const { return !(OpenMP && OpenMPIsTargetDevice); } |
674 | |
675 | /// Returns true if implicit int is part of the language requirements. |
676 | bool isImplicitIntRequired() const { return !CPlusPlus && !C99; } |
677 | |
678 | /// Returns true if implicit int is supported at all. |
679 | bool isImplicitIntAllowed() const { return !CPlusPlus && !C23; } |
680 | |
681 | /// Check if return address signing is enabled. |
682 | bool hasSignReturnAddress() const { |
683 | return getSignReturnAddressScope() != SignReturnAddressScopeKind::None; |
684 | } |
685 | |
686 | /// Check if return address signing uses AKey. |
687 | bool isSignReturnAddressWithAKey() const { |
688 | return getSignReturnAddressKey() == SignReturnAddressKeyKind::AKey; |
689 | } |
690 | |
691 | /// Check if leaf functions are also signed. |
692 | bool isSignReturnAddressScopeAll() const { |
693 | return getSignReturnAddressScope() == SignReturnAddressScopeKind::All; |
694 | } |
695 | |
696 | bool hasSjLjExceptions() const { |
697 | return getExceptionHandling() == ExceptionHandlingKind::SjLj; |
698 | } |
699 | |
700 | bool hasSEHExceptions() const { |
701 | return getExceptionHandling() == ExceptionHandlingKind::WinEH; |
702 | } |
703 | |
704 | bool hasDWARFExceptions() const { |
705 | return getExceptionHandling() == ExceptionHandlingKind::DwarfCFI; |
706 | } |
707 | |
708 | bool hasWasmExceptions() const { |
709 | return getExceptionHandling() == ExceptionHandlingKind::Wasm; |
710 | } |
711 | |
712 | bool isSYCL() const { return SYCLIsDevice || SYCLIsHost; } |
713 | |
714 | bool hasDefaultVisibilityExportMapping() const { |
715 | return getDefaultVisibilityExportMapping() != |
716 | DefaultVisiblityExportMapping::None; |
717 | } |
718 | |
719 | bool isExplicitDefaultVisibilityExportMapping() const { |
720 | return getDefaultVisibilityExportMapping() == |
721 | DefaultVisiblityExportMapping::Explicit; |
722 | } |
723 | |
724 | bool isAllDefaultVisibilityExportMapping() const { |
725 | return getDefaultVisibilityExportMapping() == |
726 | DefaultVisiblityExportMapping::All; |
727 | } |
728 | |
729 | bool hasGlobalAllocationFunctionVisibility() const { |
730 | return getGlobalAllocationFunctionVisibility() != |
731 | VisibilityForcedKinds::Source; |
732 | } |
733 | |
734 | bool hasDefaultGlobalAllocationFunctionVisibility() const { |
735 | return getGlobalAllocationFunctionVisibility() == |
736 | VisibilityForcedKinds::ForceDefault; |
737 | } |
738 | |
739 | bool hasProtectedGlobalAllocationFunctionVisibility() const { |
740 | return getGlobalAllocationFunctionVisibility() == |
741 | VisibilityForcedKinds::ForceProtected; |
742 | } |
743 | |
744 | bool hasHiddenGlobalAllocationFunctionVisibility() const { |
745 | return getGlobalAllocationFunctionVisibility() == |
746 | VisibilityForcedKinds::ForceHidden; |
747 | } |
748 | |
749 | /// Remap path prefix according to -fmacro-prefix-path option. |
750 | void remapPathPrefix(SmallVectorImpl<char> &Path) const; |
751 | |
752 | RoundingMode getDefaultRoundingMode() const { |
753 | return RoundingMath ? RoundingMode::Dynamic |
754 | : RoundingMode::NearestTiesToEven; |
755 | } |
756 | |
757 | FPExceptionModeKind getDefaultExceptionMode() const { |
758 | FPExceptionModeKind EM = getFPExceptionMode(); |
759 | if (EM == FPExceptionModeKind::FPE_Default) |
760 | return FPExceptionModeKind::FPE_Ignore; |
761 | return EM; |
762 | } |
763 | }; |
764 | |
765 | /// Floating point control options |
766 | class FPOptionsOverride; |
767 | class FPOptions { |
768 | public: |
769 | // We start by defining the layout. |
770 | using storage_type = uint32_t; |
771 | |
772 | using RoundingMode = llvm::RoundingMode; |
773 | |
774 | static constexpr unsigned StorageBitSize = 8 * sizeof(storage_type); |
775 | |
776 | // Define a fake option named "First" so that we have a PREVIOUS even for the |
777 | // real first option. |
778 | static constexpr storage_type FirstShift = 0, FirstWidth = 0; |
779 | #define OPTION(NAME, TYPE, WIDTH, PREVIOUS) \ |
780 | static constexpr storage_type NAME##Shift = \ |
781 | PREVIOUS##Shift + PREVIOUS##Width; \ |
782 | static constexpr storage_type NAME##Width = WIDTH; \ |
783 | static constexpr storage_type NAME##Mask = ((1 << NAME##Width) - 1) \ |
784 | << NAME##Shift; |
785 | #include "clang/Basic/FPOptions.def" |
786 | |
787 | static constexpr storage_type TotalWidth = 0 |
788 | #define OPTION(NAME, TYPE, WIDTH, PREVIOUS) +WIDTH |
789 | #include "clang/Basic/FPOptions.def" |
790 | ; |
791 | static_assert(TotalWidth <= StorageBitSize, "Too short type for FPOptions" ); |
792 | |
793 | private: |
794 | storage_type Value; |
795 | |
796 | FPOptionsOverride getChangesSlow(const FPOptions &Base) const; |
797 | |
798 | public: |
799 | FPOptions() : Value(0) { |
800 | setFPContractMode(LangOptions::FPM_Off); |
801 | setConstRoundingMode(RoundingMode::Dynamic); |
802 | setSpecifiedExceptionMode(LangOptions::FPE_Default); |
803 | } |
804 | explicit FPOptions(const LangOptions &LO) { |
805 | Value = 0; |
806 | // The language fp contract option FPM_FastHonorPragmas has the same effect |
807 | // as FPM_Fast in frontend. For simplicity, use FPM_Fast uniformly in |
808 | // frontend. |
809 | auto LangOptContractMode = LO.getDefaultFPContractMode(); |
810 | if (LangOptContractMode == LangOptions::FPM_FastHonorPragmas) |
811 | LangOptContractMode = LangOptions::FPM_Fast; |
812 | setFPContractMode(LangOptContractMode); |
813 | setRoundingMath(LO.RoundingMath); |
814 | setConstRoundingMode(LangOptions::RoundingMode::Dynamic); |
815 | setSpecifiedExceptionMode(LO.getFPExceptionMode()); |
816 | setAllowFPReassociate(LO.AllowFPReassoc); |
817 | setNoHonorNaNs(LO.NoHonorNaNs); |
818 | setNoHonorInfs(LO.NoHonorInfs); |
819 | setNoSignedZero(LO.NoSignedZero); |
820 | setAllowReciprocal(LO.AllowRecip); |
821 | setAllowApproxFunc(LO.ApproxFunc); |
822 | if (getFPContractMode() == LangOptions::FPM_On && |
823 | getRoundingMode() == llvm::RoundingMode::Dynamic && |
824 | getExceptionMode() == LangOptions::FPE_Strict) |
825 | // If the FP settings are set to the "strict" model, then |
826 | // FENV access is set to true. (ffp-model=strict) |
827 | setAllowFEnvAccess(true); |
828 | else |
829 | setAllowFEnvAccess(LangOptions::FPM_Off); |
830 | setComplexRange(LO.getComplexRange()); |
831 | } |
832 | |
833 | bool allowFPContractWithinStatement() const { |
834 | return getFPContractMode() == LangOptions::FPM_On; |
835 | } |
836 | void setAllowFPContractWithinStatement() { |
837 | setFPContractMode(LangOptions::FPM_On); |
838 | } |
839 | |
840 | bool allowFPContractAcrossStatement() const { |
841 | return getFPContractMode() == LangOptions::FPM_Fast; |
842 | } |
843 | void setAllowFPContractAcrossStatement() { |
844 | setFPContractMode(LangOptions::FPM_Fast); |
845 | } |
846 | |
847 | bool isFPConstrained() const { |
848 | return getRoundingMode() != llvm::RoundingMode::NearestTiesToEven || |
849 | getExceptionMode() != LangOptions::FPE_Ignore || |
850 | getAllowFEnvAccess(); |
851 | } |
852 | |
853 | RoundingMode getRoundingMode() const { |
854 | RoundingMode RM = getConstRoundingMode(); |
855 | if (RM == RoundingMode::Dynamic) { |
856 | // C23: 7.6.2p3 If the FE_DYNAMIC mode is specified and FENV_ACCESS is |
857 | // "off", the translator may assume that the default rounding mode is in |
858 | // effect. |
859 | if (!getAllowFEnvAccess() && !getRoundingMath()) |
860 | RM = RoundingMode::NearestTiesToEven; |
861 | } |
862 | return RM; |
863 | } |
864 | |
865 | LangOptions::FPExceptionModeKind getExceptionMode() const { |
866 | LangOptions::FPExceptionModeKind EM = getSpecifiedExceptionMode(); |
867 | if (EM == LangOptions::FPExceptionModeKind::FPE_Default) { |
868 | if (getAllowFEnvAccess()) |
869 | return LangOptions::FPExceptionModeKind::FPE_Strict; |
870 | else |
871 | return LangOptions::FPExceptionModeKind::FPE_Ignore; |
872 | } |
873 | return EM; |
874 | } |
875 | |
876 | bool operator==(FPOptions other) const { return Value == other.Value; } |
877 | |
878 | /// Return the default value of FPOptions that's used when trailing |
879 | /// storage isn't required. |
880 | static FPOptions defaultWithoutTrailingStorage(const LangOptions &LO); |
881 | |
882 | storage_type getAsOpaqueInt() const { return Value; } |
883 | static FPOptions getFromOpaqueInt(storage_type Value) { |
884 | FPOptions Opts; |
885 | Opts.Value = Value; |
886 | return Opts; |
887 | } |
888 | |
889 | /// Return difference with the given option set. |
890 | FPOptionsOverride getChangesFrom(const FPOptions &Base) const; |
891 | |
892 | void applyChanges(FPOptionsOverride FPO); |
893 | |
894 | // We can define most of the accessors automatically: |
895 | #define OPTION(NAME, TYPE, WIDTH, PREVIOUS) \ |
896 | TYPE get##NAME() const { \ |
897 | return static_cast<TYPE>((Value & NAME##Mask) >> NAME##Shift); \ |
898 | } \ |
899 | void set##NAME(TYPE value) { \ |
900 | Value = (Value & ~NAME##Mask) | (storage_type(value) << NAME##Shift); \ |
901 | } |
902 | #include "clang/Basic/FPOptions.def" |
903 | LLVM_DUMP_METHOD void dump(); |
904 | }; |
905 | |
906 | /// Represents difference between two FPOptions values. |
907 | /// |
908 | /// The effect of language constructs changing the set of floating point options |
909 | /// is usually a change of some FP properties while leaving others intact. This |
910 | /// class describes such changes by keeping information about what FP options |
911 | /// are overridden. |
912 | /// |
913 | /// The integral set of FP options, described by the class FPOptions, may be |
914 | /// represented as a default FP option set, defined by language standard and |
915 | /// command line options, with the overrides introduced by pragmas. |
916 | /// |
917 | /// The is implemented as a value of the new FPOptions plus a mask showing which |
918 | /// fields are actually set in it. |
919 | class FPOptionsOverride { |
920 | FPOptions Options = FPOptions::getFromOpaqueInt(Value: 0); |
921 | FPOptions::storage_type OverrideMask = 0; |
922 | |
923 | public: |
924 | using RoundingMode = llvm::RoundingMode; |
925 | |
926 | /// The type suitable for storing values of FPOptionsOverride. Must be twice |
927 | /// as wide as bit size of FPOption. |
928 | using storage_type = uint64_t; |
929 | static_assert(sizeof(storage_type) >= 2 * sizeof(FPOptions::storage_type), |
930 | "Too short type for FPOptionsOverride" ); |
931 | |
932 | /// Bit mask selecting bits of OverrideMask in serialized representation of |
933 | /// FPOptionsOverride. |
934 | static constexpr storage_type OverrideMaskBits = |
935 | (static_cast<storage_type>(1) << FPOptions::StorageBitSize) - 1; |
936 | |
937 | FPOptionsOverride() {} |
938 | FPOptionsOverride(const LangOptions &LO) |
939 | : Options(LO), OverrideMask(OverrideMaskBits) {} |
940 | FPOptionsOverride(FPOptions FPO) |
941 | : Options(FPO), OverrideMask(OverrideMaskBits) {} |
942 | FPOptionsOverride(FPOptions FPO, FPOptions::storage_type Mask) |
943 | : Options(FPO), OverrideMask(Mask) {} |
944 | |
945 | bool requiresTrailingStorage() const { return OverrideMask != 0; } |
946 | |
947 | void setAllowFPContractWithinStatement() { |
948 | setFPContractModeOverride(LangOptions::FPM_On); |
949 | } |
950 | |
951 | void setAllowFPContractAcrossStatement() { |
952 | setFPContractModeOverride(LangOptions::FPM_Fast); |
953 | } |
954 | |
955 | void setDisallowFPContract() { |
956 | setFPContractModeOverride(LangOptions::FPM_Off); |
957 | } |
958 | |
959 | void setFPPreciseEnabled(bool Value) { |
960 | setAllowFPReassociateOverride(!Value); |
961 | setNoHonorNaNsOverride(!Value); |
962 | setNoHonorInfsOverride(!Value); |
963 | setNoSignedZeroOverride(!Value); |
964 | setAllowReciprocalOverride(!Value); |
965 | setAllowApproxFuncOverride(!Value); |
966 | setMathErrnoOverride(Value); |
967 | if (Value) |
968 | /* Precise mode implies fp_contract=on and disables ffast-math */ |
969 | setAllowFPContractWithinStatement(); |
970 | else |
971 | /* Precise mode disabled sets fp_contract=fast and enables ffast-math */ |
972 | setAllowFPContractAcrossStatement(); |
973 | } |
974 | |
975 | void setDisallowOptimizations() { setFPPreciseEnabled(true); } |
976 | |
977 | storage_type getAsOpaqueInt() const { |
978 | return (static_cast<storage_type>(Options.getAsOpaqueInt()) |
979 | << FPOptions::StorageBitSize) | |
980 | OverrideMask; |
981 | } |
982 | static FPOptionsOverride getFromOpaqueInt(storage_type I) { |
983 | FPOptionsOverride Opts; |
984 | Opts.OverrideMask = I & OverrideMaskBits; |
985 | Opts.Options = FPOptions::getFromOpaqueInt(Value: I >> FPOptions::StorageBitSize); |
986 | return Opts; |
987 | } |
988 | |
989 | FPOptions applyOverrides(FPOptions Base) { |
990 | FPOptions Result = |
991 | FPOptions::getFromOpaqueInt(Value: (Base.getAsOpaqueInt() & ~OverrideMask) | |
992 | (Options.getAsOpaqueInt() & OverrideMask)); |
993 | return Result; |
994 | } |
995 | |
996 | FPOptions applyOverrides(const LangOptions &LO) { |
997 | return applyOverrides(Base: FPOptions(LO)); |
998 | } |
999 | |
1000 | bool operator==(FPOptionsOverride other) const { |
1001 | return Options == other.Options && OverrideMask == other.OverrideMask; |
1002 | } |
1003 | bool operator!=(FPOptionsOverride other) const { return !(*this == other); } |
1004 | |
1005 | #define OPTION(NAME, TYPE, WIDTH, PREVIOUS) \ |
1006 | bool has##NAME##Override() const { \ |
1007 | return OverrideMask & FPOptions::NAME##Mask; \ |
1008 | } \ |
1009 | TYPE get##NAME##Override() const { \ |
1010 | assert(has##NAME##Override()); \ |
1011 | return Options.get##NAME(); \ |
1012 | } \ |
1013 | void clear##NAME##Override() { \ |
1014 | /* Clear the actual value so that we don't have spurious differences when \ |
1015 | * testing equality. */ \ |
1016 | Options.set##NAME(TYPE(0)); \ |
1017 | OverrideMask &= ~FPOptions::NAME##Mask; \ |
1018 | } \ |
1019 | void set##NAME##Override(TYPE value) { \ |
1020 | Options.set##NAME(value); \ |
1021 | OverrideMask |= FPOptions::NAME##Mask; \ |
1022 | } |
1023 | #include "clang/Basic/FPOptions.def" |
1024 | LLVM_DUMP_METHOD void dump(); |
1025 | }; |
1026 | |
1027 | inline FPOptionsOverride FPOptions::getChangesFrom(const FPOptions &Base) const { |
1028 | if (Value == Base.Value) |
1029 | return FPOptionsOverride(); |
1030 | return getChangesSlow(Base); |
1031 | } |
1032 | |
1033 | inline void FPOptions::applyChanges(FPOptionsOverride FPO) { |
1034 | *this = FPO.applyOverrides(Base: *this); |
1035 | } |
1036 | |
1037 | /// Describes the kind of translation unit being processed. |
1038 | enum TranslationUnitKind { |
1039 | /// The translation unit is a complete translation unit. |
1040 | TU_Complete, |
1041 | |
1042 | /// The translation unit is a prefix to a translation unit, and is |
1043 | /// not complete. |
1044 | TU_Prefix, |
1045 | |
1046 | /// The translation unit is a clang module. |
1047 | TU_ClangModule, |
1048 | |
1049 | /// The translation unit is a is a complete translation unit that we might |
1050 | /// incrementally extend later. |
1051 | TU_Incremental |
1052 | }; |
1053 | |
1054 | } // namespace clang |
1055 | |
1056 | #endif // LLVM_CLANG_BASIC_LANGOPTIONS_H |
1057 | |